C8H15FOS — CID 134352282
(2R,3S,4S,5S)-2-ethyl-4-fluoro-5-methoxy-3-methylthiolane (PubChem CID 134352282) has the molecular formula C8H15FOS and a molecular weight of 178.27 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-ethyl-4-fluoro-5-methoxy-3-methylthiolane.
| Compound Name | (2R,3S,4S,5S)-2-ethyl-4-fluoro-5-methoxy-3-methylthiolane |
|---|---|
| PubChem CID | 134352282 |
| Molecular Formula | C8H15FOS |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (2R,3S,4S,5S)-2-ethyl-4-fluoro-5-methoxy-3-methylthiolane |
| SMILES | CC[C@@H]1[C@H]([C@@H]([C@H](S1)OC)F)C |
| InChI | InChI=1S/C8H15FOS/c1-4-6-5(2)7(9)8(10-3)11-6/h5-8H,4H2,1-3H3/t5-,6-,7+,8+/m1/s1 |
| InChIKey | NMYSVGAMZZZYDQ-NGJRWZKOSA-N |
| XLogP | 2.80 |
| TPSA | 34.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | 131 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |