C22H25F3N6S — CID 134352931
4-[2-(2-methyl-4,5,6,7-tetrahydroindazol-4-yl)-2,7-diazaspiro[3.4]octan-7-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine (PubChem CID 134352931) has the molecular formula C22H25F3N6S and a molecular weight of 462.55 g/mol. Its IUPAC name is 4-[2-(2-methyl-4,5,6,7-tetrahydroindazol-4-yl)-2,7-diazaspiro[3.4]octan-7-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[2-(2-methyl-4,5,6,7-tetrahydroindazol-4-yl)-2,7-diazaspiro[3.4]octan-7-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 134352931 |
| Molecular Formula | C22H25F3N6S |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 4-[2-(2-methyl-4,5,6,7-tetrahydroindazol-4-yl)-2,7-diazaspiro[3.4]octan-7-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
| SMILES | Cn1cc2c(n1)CCCC2N1CC2(CCN(c3ncnc4sc(CC(F)(F)F)cc34)C2)C1 |
| InChI | InChI=1S/C22H25F3N6S/c1-29-9-16-17(28-29)3-2-4-18(16)31-11-21(12-31)5-6-30(10-21)19-15-7-14(8-22(23,24)25)32-20(15)27-13-26-19/h7,9,13,18H,2-6,8,10-12H2,1H3 |
| InChIKey | QFPZYAHHNKMSAE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |