C22H25F3N4S — CID 134352992
4-[2-[(3-methylcyclohexa-1,5-dien-1-yl)methyl]-2,7-diazaspiro[3.4]octan-7-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine (PubChem CID 134352992) has the molecular formula C22H25F3N4S and a molecular weight of 434.53 g/mol. Its IUPAC name is 4-[2-[(3-methylcyclohexa-1,5-dien-1-yl)methyl]-2,7-diazaspiro[3.4]octan-7-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[2-[(3-methylcyclohexa-1,5-dien-1-yl)methyl]-2,7-diazaspiro[3.4]octan-7-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 134352992 |
| Molecular Formula | C22H25F3N4S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 4-[2-[(3-methylcyclohexa-1,5-dien-1-yl)methyl]-2,7-diazaspiro[3.4]octan-7-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
| SMILES | CC1C=C(CN2CC3(CCN(c4ncnc5sc(CC(F)(F)F)cc45)C3)C2)C=CC1 |
| InChI | InChI=1S/C22H25F3N4S/c1-15-3-2-4-16(7-15)10-28-11-21(12-28)5-6-29(13-21)19-18-8-17(9-22(23,24)25)30-20(18)27-14-26-19/h2,4,7-8,14-15H,3,5-6,9-13H2,1H3 |
| InChIKey | HBSWMSRZSCJZAM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |