C9H15NO — CID 134352996
4-methyl-2,3,4a,5,8,8a-hexahydro-1,4-benzoxazine (PubChem CID 134352996) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is 4-methyl-2,3,4a,5,8,8a-hexahydro-1,4-benzoxazine.
| Compound Name | 4-methyl-2,3,4a,5,8,8a-hexahydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 134352996 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4-methyl-2,3,4a,5,8,8a-hexahydro-1,4-benzoxazine |
| SMILES | CN1CCOC2CC=CCC21 |
| InChI | InChI=1S/C9H15NO/c1-10-6-7-11-9-5-3-2-4-8(9)10/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | WAPYLTFMLSOUDR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|