C23H29F3N6S — CID 134353360
4-[2-[(1R,2R)-2-methyl-1-(1-methylpyrazol-4-yl)butyl]-2,7-diazaspiro[3.4]octan-7-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine (PubChem CID 134353360) has the molecular formula C23H29F3N6S and a molecular weight of 478.59 g/mol. Its IUPAC name is 4-[2-[(1R,2R)-2-methyl-1-(1-methylpyrazol-4-yl)butyl]-2,7-diazaspiro[3.4]octan-7-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[2-[(1R,2R)-2-methyl-1-(1-methylpyrazol-4-yl)butyl]-2,7-diazaspiro[3.4]octan-7-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 134353360 |
| Molecular Formula | C23H29F3N6S |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 4-[2-[(1R,2R)-2-methyl-1-(1-methylpyrazol-4-yl)butyl]-2,7-diazaspiro[3.4]octan-7-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
| SMILES | CC[C@@H](C)[C@H](c1cnn(C)c1)N1CC2(CCN(c3ncnc4sc(CC(F)(F)F)cc34)C2)C1 |
| InChI | InChI=1S/C23H29F3N6S/c1-4-15(2)19(16-9-29-30(3)10-16)32-12-22(13-32)5-6-31(11-22)20-18-7-17(8-23(24,25)26)33-21(18)28-14-27-20/h7,9-10,14-15,19H,4-6,8,11-13H2,1-3H3/t15-,19-/m1/s1 |
| InChIKey | UTFKBVQSDIMOEZ-DNVCBOLYSA-N |
| XLogP | 4.83 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |