About (1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride
(1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride (PubChem CID 134353387) has the molecular formula C12H22ClNO
and a molecular weight of 231.77 g/mol. Its IUPAC name is (1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride.
Molecular Properties
| Compound Name | (1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride |
| PubChem CID | 134353387 |
| Molecular Formula | C12H22ClNO |
| Molecular Weight | 231.77 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | (1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride |
| SMILES | CC1(C)CCCC(C)(/C(Cl)=N/O)CCC1 |
| InChI | InChI=1S/C12H22ClNO/c1-11(2)6-4-8-12(3,9-5-7-11)10(13)14-15/h15H,4-9H2,1-3H3/b14-10- |
| InChIKey | HPLPLYVLLMLTDL-UVTDQMKNSA-N |
| XLogP | 4.40 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.77 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride?
The IUPAC name of (1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride (CID 134353387) is (1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride.
What is the SMILES notation for (1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride?
The canonical SMILES for (1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride is CC1(C)CCCC(C)(/C(Cl)=N/O)CCC1.
What is the InChIKey of (1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride?
The InChIKey is HPLPLYVLLMLTDL-UVTDQMKNSA-N. The full InChI is InChI=1S/C12H22ClNO/c1-11(2)6-4-8-12(3,9-5-7-11)10(13)14-15/h15H,4-9H2,1-3H3/b14-10-.
What are the key properties of (1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride?
(1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride has a molecular weight of 231.77 g/mol, XLogP of 4.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-N-hydroxy-1,5,5-trimethylcyclooctane-1-carboximidoyl chloride is sourced from PubChem (CID 134353387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).