About 3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine
3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine (PubChem CID 134353390) has the molecular formula C26H49NO
and a molecular weight of 391.68 g/mol. Its IUPAC name is 3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine.
Molecular Properties
| Compound Name | 3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine |
| PubChem CID | 134353390 |
| Molecular Formula | C26H49NO |
| Molecular Weight | 391.68 g/mol |
| Exact Mass | 391.38 |
| IUPAC Name | 3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine |
| SMILES | CC1(OC2(C)CCCCC(C)(C3CCNC3)CCC2)CCCCCCCCC1 |
| InChI | InChI=1S/C26H49NO/c1-24(23-14-21-27-22-23)15-11-12-19-26(3,20-13-16-24)28-25(2)17-9-7-5-4-6-8-10-18-25/h23,27H,4-22H2,1-3H3 |
| InChIKey | IGVIPMVLWISIDW-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.68 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine?
The IUPAC name of 3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine (CID 134353390) is 3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine.
What is the SMILES notation for 3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine?
The canonical SMILES for 3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine is CC1(OC2(C)CCCCC(C)(C3CCNC3)CCC2)CCCCCCCCC1.
What is the InChIKey of 3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine?
The InChIKey is IGVIPMVLWISIDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H49NO/c1-24(23-14-21-27-22-23)15-11-12-19-26(3,20-13-16-24)28-25(2)17-9-7-5-4-6-8-10-18-25/h23,27H,4-22H2,1-3H3.
What are the key properties of 3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine?
3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine has a molecular weight of 391.68 g/mol, XLogP of 7.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,5-dimethyl-5-(1-methylcyclodecyl)oxycyclononyl]pyrrolidine is sourced from PubChem (CID 134353390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).