C21H21N3O4 — CID 134354034
[3-oxo-3-[[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]amino]prop-1-en-2-yl] N-methyl-2-phenylethanimidate (PubChem CID 134354034) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is [3-oxo-3-[[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]amino]prop-1-en-2-yl] N-methyl-2-phenylethanimidate.
| Compound Name | [3-oxo-3-[[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]amino]prop-1-en-2-yl] N-methyl-2-phenylethanimidate |
|---|---|
| PubChem CID | 134354034 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [3-oxo-3-[[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]amino]prop-1-en-2-yl] N-methyl-2-phenylethanimidate |
| SMILES | C=C(O/C(Cc1ccccc1)=N/C)C(=O)N[C@H]1COc2ccccc2NC1=O |
| InChI | InChI=1S/C21H21N3O4/c1-14(28-19(22-2)12-15-8-4-3-5-9-15)20(25)24-17-13-27-18-11-7-6-10-16(18)23-21(17)26/h3-11,17H,1,12-13H2,2H3,(H,23,26)(H,24,25)/b22-19+/t17-/m0/s1 |
| InChIKey | DAVHQIMWISSOSO-XENKUQMPSA-N |
| XLogP | 2.30 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|