About 4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid
4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid (PubChem CID 134354057) has the molecular formula C23H23N3O6
and a molecular weight of 437.45 g/mol. Its IUPAC name is 4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid.
Molecular Properties
| Compound Name | 4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid |
| PubChem CID | 134354057 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid |
| SMILES | C[C@H](COc1ccc(C(=O)O)cc1N(C)C=O)NC(=O)c1cc(Cc2ccccc2)on1 |
| InChI | InChI=1S/C23H23N3O6/c1-15(13-31-21-9-8-17(23(29)30)11-20(21)26(2)14-27)24-22(28)19-12-18(32-25-19)10-16-6-4-3-5-7-16/h3-9,11-12,14-15H,10,13H2,1-2H3,(H,24,28)(H,29,30)/t15-/m1/s1 |
| InChIKey | XPEPVLDQULHKQR-OAHLLOKOSA-N |
| XLogP | 2.75 |
| TPSA | 121.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid?
The IUPAC name of 4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid (CID 134354057) is 4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid.
What is the SMILES notation for 4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid?
The canonical SMILES for 4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid is C[C@H](COc1ccc(C(=O)O)cc1N(C)C=O)NC(=O)c1cc(Cc2ccccc2)on1.
What is the InChIKey of 4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid?
The InChIKey is XPEPVLDQULHKQR-OAHLLOKOSA-N. The full InChI is InChI=1S/C23H23N3O6/c1-15(13-31-21-9-8-17(23(29)30)11-20(21)26(2)14-27)24-22(28)19-12-18(32-25-19)10-16-6-4-3-5-7-16/h3-9,11-12,14-15H,10,13H2,1-2H3,(H,24,28)(H,29,30)/t15-/m1/s1.
What are the key properties of 4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid?
4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid has a molecular weight of 437.45 g/mol, XLogP of 2.75, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-2-[(5-benzyl-1,2-oxazole-3-carbonyl)amino]propoxy]-3-[formyl(methyl)amino]benzoic acid is sourced from PubChem (CID 134354057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).