About N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide
N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide (PubChem CID 134354235) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide.
Molecular Properties
| Compound Name | N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide |
| PubChem CID | 134354235 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide |
| SMILES | C=C/C=C(/OCCC)C(=C)N(C)C=O |
| InChI | InChI=1S/C11H17NO2/c1-5-7-11(14-8-6-2)10(3)12(4)9-13/h5,7,9H,1,3,6,8H2,2,4H3/b11-7+ |
| InChIKey | DOBOBEHXYCXYBQ-YRNVUSSQSA-N |
| XLogP | 2.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide?
The IUPAC name of N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide (CID 134354235) is N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide.
What is the SMILES notation for N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide?
The canonical SMILES for N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide is C=C/C=C(/OCCC)C(=C)N(C)C=O.
What is the InChIKey of N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide?
The InChIKey is DOBOBEHXYCXYBQ-YRNVUSSQSA-N. The full InChI is InChI=1S/C11H17NO2/c1-5-7-11(14-8-6-2)10(3)12(4)9-13/h5,7,9H,1,3,6,8H2,2,4H3/b11-7+.
What are the key properties of N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide?
N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide has a molecular weight of 195.26 g/mol, XLogP of 2.08, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(3E)-3-propoxyhexa-1,3,5-trien-2-yl]formamide is sourced from PubChem (CID 134354235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).