C25H46N2 — CID 134354600
3-methyl-1-N-nonyl-1-N-octylcyclohepta-1,3,5-triene-1,4-diamine (PubChem CID 134354600) has the molecular formula C25H46N2 and a molecular weight of 374.66 g/mol. Its IUPAC name is 3-methyl-1-N-nonyl-1-N-octylcyclohepta-1,3,5-triene-1,4-diamine.
| Compound Name | 3-methyl-1-N-nonyl-1-N-octylcyclohepta-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 134354600 |
| Molecular Formula | C25H46N2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 374.37 |
| IUPAC Name | 3-methyl-1-N-nonyl-1-N-octylcyclohepta-1,3,5-triene-1,4-diamine |
| SMILES | CCCCCCCCCN(CCCCCCCC)C1=CC(C)=C(N)C=CC1 |
| InChI | InChI=1S/C25H46N2/c1-4-6-8-10-12-14-16-21-27(20-15-13-11-9-7-5-2)24-18-17-19-25(26)23(3)22-24/h17,19,22H,4-16,18,20-21,26H2,1-3H3 |
| InChIKey | IPFVDLARQOFUGA-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|