C26H48N2 — CID 134354604
1-N-decyl-3-methyl-1-N-octylcyclohepta-1,3,5-triene-1,4-diamine (PubChem CID 134354604) has the molecular formula C26H48N2 and a molecular weight of 388.68 g/mol. Its IUPAC name is 1-N-decyl-3-methyl-1-N-octylcyclohepta-1,3,5-triene-1,4-diamine.
| Compound Name | 1-N-decyl-3-methyl-1-N-octylcyclohepta-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 134354604 |
| Molecular Formula | C26H48N2 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 388.38 |
| IUPAC Name | 1-N-decyl-3-methyl-1-N-octylcyclohepta-1,3,5-triene-1,4-diamine |
| SMILES | CCCCCCCCCCN(CCCCCCCC)C1=CC(C)=C(N)C=CC1 |
| InChI | InChI=1S/C26H48N2/c1-4-6-8-10-12-13-15-17-22-28(21-16-14-11-9-7-5-2)25-19-18-20-26(27)24(3)23-25/h18,20,23H,4-17,19,21-22,27H2,1-3H3 |
| InChIKey | GMNOVDCNTWNSRL-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|