C11H20OS — CID 134355384
(7Z)-4,4,6,8-tetramethyl-2,3,5,6-tetrahydrothiocin-5-ol (PubChem CID 134355384) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is (7Z)-4,4,6,8-tetramethyl-2,3,5,6-tetrahydrothiocin-5-ol.
| Compound Name | (7Z)-4,4,6,8-tetramethyl-2,3,5,6-tetrahydrothiocin-5-ol |
|---|---|
| PubChem CID | 134355384 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (7Z)-4,4,6,8-tetramethyl-2,3,5,6-tetrahydrothiocin-5-ol |
| SMILES | C/C1=C/C(C)C(O)C(C)(C)CCS1 |
| InChI | InChI=1S/C11H20OS/c1-8-7-9(2)13-6-5-11(3,4)10(8)12/h7-8,10,12H,5-6H2,1-4H3/b9-7- |
| InChIKey | OLKDMBSFFYISTK-CLFYSBASSA-N |
| XLogP | 3.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |