C10H16S — CID 134355442
(3aR,8aR)-2-methyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[b]thiophene (PubChem CID 134355442) has the molecular formula C10H16S and a molecular weight of 168.31 g/mol. Its IUPAC name is (3aR,8aR)-2-methyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[b]thiophene.
| Compound Name | (3aR,8aR)-2-methyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[b]thiophene |
|---|---|
| PubChem CID | 134355442 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (3aR,8aR)-2-methyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[b]thiophene |
| SMILES | CC1=C[C@H]2CCCCC[C@H]2S1 |
| InChI | InChI=1S/C10H16S/c1-8-7-9-5-3-2-4-6-10(9)11-8/h7,9-10H,2-6H2,1H3/t9-,10-/m1/s1 |
| InChIKey | CYBIWZMGYXSWKC-NXEZZACHSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |