C18H16ClN5O6 — CID 13435546
propyl 2-[3-(4-chlorophenyl)-4-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate (PubChem CID 13435546) has the molecular formula C18H16ClN5O6 and a molecular weight of 433.81 g/mol. Its IUPAC name is propyl 2-[3-(4-chlorophenyl)-4-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate.
| Compound Name | propyl 2-[3-(4-chlorophenyl)-4-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate |
|---|---|
| PubChem CID | 13435546 |
| Molecular Formula | C18H16ClN5O6 |
| Molecular Weight | 433.81 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | propyl 2-[3-(4-chlorophenyl)-4-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-oxo-1,2,4-triazol-1-yl]acetate |
| SMILES | CCCOC(=O)Cn1nc(-c2ccc(Cl)cc2)n(/N=C/c2ccc([N+](=O)[O-])o2)c1=O |
| InChI | InChI=1S/C18H16ClN5O6/c1-2-9-29-16(25)11-22-18(26)23(17(21-22)12-3-5-13(19)6-4-12)20-10-14-7-8-15(30-14)24(27)28/h3-8,10H,2,9,11H2,1H3/b20-10+ |
| InChIKey | NVDPWWDLXXPUON-KEBDBYFISA-N |
| XLogP | 2.70 |
| TPSA | 134.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|