C26H27FN6O2S — CID 134355460
(1S,7R)-N-[2-fluoro-5-[6-oxo-5-[(1,2,5-trimethyl-3H-pyrazol-3-yl)amino]-1H-pyridazin-3-yl]phenyl]-3-thiatricyclo[5.2.1.02,6]deca-2(6),4-diene-4-carboxamide (PubChem CID 134355460) has the molecular formula C26H27FN6O2S and a molecular weight of 506.61 g/mol. Its IUPAC name is (1S,7R)-N-[2-fluoro-5-[6-oxo-5-[(1,2,5-trimethyl-3H-pyrazol-3-yl)amino]-1H-pyridazin-3-yl]phenyl]-3-thiatricyclo[5.2.1.02,6]deca-2(6),4-diene-4-carboxamide.
| Compound Name | (1S,7R)-N-[2-fluoro-5-[6-oxo-5-[(1,2,5-trimethyl-3H-pyrazol-3-yl)amino]-1H-pyridazin-3-yl]phenyl]-3-thiatricyclo[5.2.1.02,6]deca-2(6),4-diene-4-carboxamide |
|---|---|
| PubChem CID | 134355460 |
| Molecular Formula | C26H27FN6O2S |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | (1S,7R)-N-[2-fluoro-5-[6-oxo-5-[(1,2,5-trimethyl-3H-pyrazol-3-yl)amino]-1H-pyridazin-3-yl]phenyl]-3-thiatricyclo[5.2.1.02,6]deca-2(6),4-diene-4-carboxamide |
| SMILES | CC1=CC(Nc2cc(-c3ccc(F)c(NC(=O)c4cc5c(s4)[C@H]4CC[C@@H]5C4)c3)n[nH]c2=O)N(C)N1C |
| InChI | InChI=1S/C26H27FN6O2S/c1-13-8-23(33(3)32(13)2)28-21-12-19(30-31-25(21)34)15-6-7-18(27)20(10-15)29-26(35)22-11-17-14-4-5-16(9-14)24(17)36-22/h6-8,10-12,14,16,23H,4-5,9H2,1-3H3,(H,28,30)(H,29,35)(H,31,34)/t14-,16+,23?/m1/s1 |
| InChIKey | SDFCXQPGNNODRV-MNJWVGMUSA-N |
| XLogP | 4.69 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |