C22H35N3O2 — CID 134355586
(3R)-N-[(2S)-1-[(3R,4R)-3,4-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-7-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 134355586) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is (3R)-N-[(2S)-1-[(3R,4R)-3,4-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-7-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3R)-N-[(2S)-1-[(3R,4R)-3,4-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-7-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 134355586 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | (3R)-N-[(2S)-1-[(3R,4R)-3,4-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-7-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | CC(C)[C@@H](CN1CC[C@@H](C)[C@@H](C)C1)NC(=O)[C@H]1Cc2ccc(O)cc2CN1 |
| InChI | InChI=1S/C22H35N3O2/c1-14(2)21(13-25-8-7-15(3)16(4)12-25)24-22(27)20-10-17-5-6-19(26)9-18(17)11-23-20/h5-6,9,14-16,20-21,23,26H,7-8,10-13H2,1-4H3,(H,24,27)/t15-,16+,20-,21-/m1/s1 |
| InChIKey | CLCFQLVMHMQZBB-VAKZPMALSA-N |
| XLogP | 2.53 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |