C16H21N3O6 — CID 134355891
(2,5-dioxopyrrolidin-1-yl) 4-amino-4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylhexanoate (PubChem CID 134355891) has the molecular formula C16H21N3O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-amino-4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylhexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-amino-4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 134355891 |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-amino-4-(2,5-dioxopyrrol-1-yl)-2,2-dimethylhexanoate |
| SMILES | CCC(N)(CC(C)(C)C(=O)ON1C(=O)CCC1=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H21N3O6/c1-4-16(17,18-10(20)5-6-11(18)21)9-15(2,3)14(24)25-19-12(22)7-8-13(19)23/h5-6H,4,7-9,17H2,1-3H3 |
| InChIKey | YCLJHNSGVWZVBY-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|