C15H27NO4 — CID 134356264
3-cyclohexyloxy-N-(cyclopentylmethyl)-2,3-dihydroxypropanamide (PubChem CID 134356264) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is 3-cyclohexyloxy-N-(cyclopentylmethyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-cyclohexyloxy-N-(cyclopentylmethyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 134356264 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 3-cyclohexyloxy-N-(cyclopentylmethyl)-2,3-dihydroxypropanamide |
| SMILES | O=C(NCC1CCCC1)C(O)C(O)OC1CCCCC1 |
| InChI | InChI=1S/C15H27NO4/c17-13(14(18)16-10-11-6-4-5-7-11)15(19)20-12-8-2-1-3-9-12/h11-13,15,17,19H,1-10H2,(H,16,18) |
| InChIKey | MNFSANKSNRFSGX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|