C21H17N5O2S — CID 1343565
(E)-3-(furan-2-yl)-N-[[2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]prop-2-enamide (PubChem CID 1343565) has the molecular formula C21H17N5O2S and a molecular weight of 403.47 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[[2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[[2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 1343565 |
| Molecular Formula | C21H17N5O2S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[[2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(-n2nc3ccc(NC(=S)NC(=O)/C=C/c4ccco4)cc3n2)cc1 |
| InChI | InChI=1S/C21H17N5O2S/c1-14-4-7-16(8-5-14)26-24-18-10-6-15(13-19(18)25-26)22-21(29)23-20(27)11-9-17-3-2-12-28-17/h2-13H,1H3,(H2,22,23,27,29)/b11-9+ |
| InChIKey | PIACARLBZQHJRZ-PKNBQFBNSA-N |
| XLogP | 3.85 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|