C13H17F3N2O — CID 134356612
1-[(3S)-3,4,4-trifluoro-1-[N-[(Z)-prop-1-enyl]-C-prop-1-en-2-ylcarbonimidoyl]pyrrolidin-3-yl]ethanone (PubChem CID 134356612) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 1-[(3S)-3,4,4-trifluoro-1-[N-[(Z)-prop-1-enyl]-C-prop-1-en-2-ylcarbonimidoyl]pyrrolidin-3-yl]ethanone.
| Compound Name | 1-[(3S)-3,4,4-trifluoro-1-[N-[(Z)-prop-1-enyl]-C-prop-1-en-2-ylcarbonimidoyl]pyrrolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 134356612 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-[(3S)-3,4,4-trifluoro-1-[N-[(Z)-prop-1-enyl]-C-prop-1-en-2-ylcarbonimidoyl]pyrrolidin-3-yl]ethanone |
| SMILES | C=C(C)/C(=N\C=C/C)N1CC(F)(F)[C@@](F)(C(C)=O)C1 |
| InChI | InChI=1S/C13H17F3N2O/c1-5-6-17-11(9(2)3)18-7-12(14,10(4)19)13(15,16)8-18/h5-6H,2,7-8H2,1,3-4H3/b6-5-,17-11+/t12-/m0/s1 |
| InChIKey | WQIYVZYCBXVMSH-ZRGFOFJZSA-N |
| XLogP | 2.74 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|