C23H37N3O6 — CID 134356627
tert-butyl N-[(5S)-7-[(2,6-dimethyl-4-pyridinyl)oxy]-5-(2-methoxypropanoylamino)-6-oxoheptyl]carbamate (PubChem CID 134356627) has the molecular formula C23H37N3O6 and a molecular weight of 451.56 g/mol. Its IUPAC name is tert-butyl N-[(5S)-7-[(2,6-dimethyl-4-pyridinyl)oxy]-5-(2-methoxypropanoylamino)-6-oxoheptyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-7-[(2,6-dimethyl-4-pyridinyl)oxy]-5-(2-methoxypropanoylamino)-6-oxoheptyl]carbamate |
|---|---|
| PubChem CID | 134356627 |
| Molecular Formula | C23H37N3O6 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | tert-butyl N-[(5S)-7-[(2,6-dimethyl-4-pyridinyl)oxy]-5-(2-methoxypropanoylamino)-6-oxoheptyl]carbamate |
| SMILES | COC(C)C(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)COc1cc(C)nc(C)c1 |
| InChI | InChI=1S/C23H37N3O6/c1-15-12-18(13-16(2)25-15)31-14-20(27)19(26-21(28)17(3)30-7)10-8-9-11-24-22(29)32-23(4,5)6/h12-13,17,19H,8-11,14H2,1-7H3,(H,24,29)(H,26,28)/t17?,19-/m0/s1 |
| InChIKey | NSNCWHCISMGGCK-NNBQYGFHSA-N |
| XLogP | 2.86 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|