About 4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine
4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine (PubChem CID 134356799) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 134356799 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine |
| SMILES | CC/N=N/C1=CCC(N(C)C)C=C1 |
| InChI | InChI=1S/C10H17N3/c1-4-11-12-9-5-7-10(8-6-9)13(2)3/h5-7,10H,4,8H2,1-3H3/b12-11+ |
| InChIKey | QAUIJMKLXCYOAO-VAWYXSNFSA-N |
| XLogP | 2.23 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine (CID 134356799) is 4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine is CC/N=N/C1=CCC(N(C)C)C=C1.
What is the InChIKey of 4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine?
The InChIKey is QAUIJMKLXCYOAO-VAWYXSNFSA-N. The full InChI is InChI=1S/C10H17N3/c1-4-11-12-9-5-7-10(8-6-9)13(2)3/h5-7,10H,4,8H2,1-3H3/b12-11+.
What are the key properties of 4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine?
4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine has a molecular weight of 179.27 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethyldiazenyl)-N,N-dimethylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 134356799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).