C21H26N2 — CID 134356896
(4Z,6Z)-5-cyclohexa-1,3-dien-1-yl-7-cyclopenta-1,3-dien-1-yl-7-(ethylideneamino)-2-methylhepta-2,4,6-trien-3-amine (PubChem CID 134356896) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is (4Z,6Z)-5-cyclohexa-1,3-dien-1-yl-7-cyclopenta-1,3-dien-1-yl-7-(ethylideneamino)-2-methylhepta-2,4,6-trien-3-amine.
| Compound Name | (4Z,6Z)-5-cyclohexa-1,3-dien-1-yl-7-cyclopenta-1,3-dien-1-yl-7-(ethylideneamino)-2-methylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 134356896 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (4Z,6Z)-5-cyclohexa-1,3-dien-1-yl-7-cyclopenta-1,3-dien-1-yl-7-(ethylideneamino)-2-methylhepta-2,4,6-trien-3-amine |
| SMILES | C/C=N/C(=C\C(=C\C(N)=C(C)C)C1=CC=CCC1)C1=CC=CC1 |
| InChI | InChI=1S/C21H26N2/c1-4-23-21(18-12-8-9-13-18)15-19(14-20(22)16(2)3)17-10-6-5-7-11-17/h4-6,8-10,12,14-15H,7,11,13,22H2,1-3H3/b19-14-,21-15-,23-4+ |
| InChIKey | KLNRYTGYMPAQRP-PGLBYUJLSA-N |
| XLogP | 5.30 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|