C13H16N2O — CID 134357140
4a-methyl-9-nitroso-3,4,5,8-tetrahydro-2H-benzo[7]annulene-9-carbonitrile (PubChem CID 134357140) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 4a-methyl-9-nitroso-3,4,5,8-tetrahydro-2H-benzo[7]annulene-9-carbonitrile.
| Compound Name | 4a-methyl-9-nitroso-3,4,5,8-tetrahydro-2H-benzo[7]annulene-9-carbonitrile |
|---|---|
| PubChem CID | 134357140 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4a-methyl-9-nitroso-3,4,5,8-tetrahydro-2H-benzo[7]annulene-9-carbonitrile |
| SMILES | CC12CC=CCC(C#N)(N=O)C1=CCCC2 |
| InChI | InChI=1S/C13H16N2O/c1-12-7-3-2-6-11(12)13(10-14,15-16)9-5-4-8-12/h4-6H,2-3,7-9H2,1H3 |
| InChIKey | YLKOMUBMNKJJEL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|