C12H13BrN2O3S — CID 134357890
3-bromo-12,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[1,2-b][1,2,5]benzothiadiazepin-6-one (PubChem CID 134357890) has the molecular formula C12H13BrN2O3S and a molecular weight of 345.22 g/mol. Its IUPAC name is 3-bromo-12,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[1,2-b][1,2,5]benzothiadiazepin-6-one.
| Compound Name | 3-bromo-12,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[1,2-b][1,2,5]benzothiadiazepin-6-one |
|---|---|
| PubChem CID | 134357890 |
| Molecular Formula | C12H13BrN2O3S |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 3-bromo-12,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[1,2-b][1,2,5]benzothiadiazepin-6-one |
| SMILES | O=C1Nc2cc(Br)ccc2S(=O)(=O)N2CCCCC12 |
| InChI | InChI=1S/C12H13BrN2O3S/c13-8-4-5-11-9(7-8)14-12(16)10-3-1-2-6-15(10)19(11,17)18/h4-5,7,10H,1-3,6H2,(H,14,16) |
| InChIKey | AVMAACZBJWERNI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |