About (3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene
(3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene (PubChem CID 134358125) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is (3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene.
Molecular Properties
| Compound Name | (3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene |
| PubChem CID | 134358125 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene |
| SMILES | CCOC/C=C1\CCc2c(C)cccc21 |
| InChI | InChI=1S/C14H18O/c1-3-15-10-9-12-7-8-13-11(2)5-4-6-14(12)13/h4-6,9H,3,7-8,10H2,1-2H3/b12-9+ |
| InChIKey | OLBCDAHTNWKDSY-FMIVXFBMSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene?
The IUPAC name of (3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene (CID 134358125) is (3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene.
What is the SMILES notation for (3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene?
The canonical SMILES for (3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene is CCOC/C=C1\CCc2c(C)cccc21.
What is the InChIKey of (3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene?
The InChIKey is OLBCDAHTNWKDSY-FMIVXFBMSA-N. The full InChI is InChI=1S/C14H18O/c1-3-15-10-9-12-7-8-13-11(2)5-4-6-14(12)13/h4-6,9H,3,7-8,10H2,1-2H3/b12-9+.
What are the key properties of (3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene?
(3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene has a molecular weight of 202.30 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(2-ethoxyethylidene)-7-methyl-1,2-dihydroindene is sourced from PubChem (CID 134358125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).