About [5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate
[5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 134358879) has the molecular formula C27H26F3NO5S
and a molecular weight of 533.57 g/mol. Its IUPAC name is [5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | [5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate |
| PubChem CID | 134358879 |
| Molecular Formula | C27H26F3NO5S |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | [5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | CCCCC(CC)Cc1cc2c3c(cccc3c1)C(=O)N(OS(=O)(=O)c1ccc(C(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C27H26F3NO5S/c1-3-5-7-17(4-2)14-18-15-19-8-6-9-22-24(19)23(16-18)26(33)31(25(22)32)36-37(34,35)21-12-10-20(11-13-21)27(28,29)30/h6,8-13,15-17H,3-5,7,14H2,1-2H3 |
| InChIKey | VMCUMSCBLQPUCW-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate?
The IUPAC name of [5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate (CID 134358879) is [5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for [5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate?
The canonical SMILES for [5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate is CCCCC(CC)Cc1cc2c3c(cccc3c1)C(=O)N(OS(=O)(=O)c1ccc(C(F)(F)F)cc1)C2=O.
What is the InChIKey of [5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate?
The InChIKey is VMCUMSCBLQPUCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26F3NO5S/c1-3-5-7-17(4-2)14-18-15-19-8-6-9-22-24(19)23(16-18)26(33)31(25(22)32)36-37(34,35)21-12-10-20(11-13-21)27(28,29)30/h6,8-13,15-17H,3-5,7,14H2,1-2H3.
What are the key properties of [5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate?
[5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate has a molecular weight of 533.57 g/mol, XLogP of 6.53, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-ethylhexyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] 4-(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 134358879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).