C16H17Cl4N3S — CID 134359633
N-(3,4-dichlorophenyl)sulfanyl-N'-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropane-1,3-diamine (PubChem CID 134359633) has the molecular formula C16H17Cl4N3S and a molecular weight of 425.21 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)sulfanyl-N'-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropane-1,3-diamine.
| Compound Name | N-(3,4-dichlorophenyl)sulfanyl-N'-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 134359633 |
| Molecular Formula | C16H17Cl4N3S |
| Molecular Weight | 425.21 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | N-(3,4-dichlorophenyl)sulfanyl-N'-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropane-1,3-diamine |
| SMILES | CC(C)(CNSc1ccc(Cl)c(Cl)c1)CNc1c(Cl)cncc1Cl |
| InChI | InChI=1S/C16H17Cl4N3S/c1-16(2,8-22-15-13(19)6-21-7-14(15)20)9-23-24-10-3-4-11(17)12(18)5-10/h3-7,23H,8-9H2,1-2H3,(H,21,22) |
| InChIKey | MTJLQQBGISPPQG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.21 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|