C28H34F6O2S2 — CID 134360186
ethyl (6R)-3,3-dimethyl-6,8-bis[[4-(trifluoromethyl)phenyl]methylsulfanyl]octanoate (PubChem CID 134360186) has the molecular formula C28H34F6O2S2 and a molecular weight of 580.70 g/mol. Its IUPAC name is ethyl (6R)-3,3-dimethyl-6,8-bis[[4-(trifluoromethyl)phenyl]methylsulfanyl]octanoate.
| Compound Name | ethyl (6R)-3,3-dimethyl-6,8-bis[[4-(trifluoromethyl)phenyl]methylsulfanyl]octanoate |
|---|---|
| PubChem CID | 134360186 |
| Molecular Formula | C28H34F6O2S2 |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | ethyl (6R)-3,3-dimethyl-6,8-bis[[4-(trifluoromethyl)phenyl]methylsulfanyl]octanoate |
| SMILES | CCOC(=O)CC(C)(C)CC[C@H](CCSCc1ccc(C(F)(F)F)cc1)SCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H34F6O2S2/c1-4-36-25(35)17-26(2,3)15-13-24(38-19-21-7-11-23(12-8-21)28(32,33)34)14-16-37-18-20-5-9-22(10-6-20)27(29,30)31/h5-12,24H,4,13-19H2,1-3H3/t24-/m1/s1 |
| InChIKey | CXBMRDWVOHURGM-XMMPIXPASA-N |
| XLogP | 9.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|