C23H25N3O3S — CID 134360413
[2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-yl] cyclohex-3-ene-1-carboxylate (PubChem CID 134360413) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-yl] cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-yl] cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134360413 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-yl] cyclohex-3-ene-1-carboxylate |
| SMILES | COc1c(C)cnc(CSc2nc3ccc(OC(=O)C4CC=CCC4)cc3[nH]2)c1C |
| InChI | InChI=1S/C23H25N3O3S/c1-14-12-24-20(15(2)21(14)28-3)13-30-23-25-18-10-9-17(11-19(18)26-23)29-22(27)16-7-5-4-6-8-16/h4-5,9-12,16H,6-8,13H2,1-3H3,(H,25,26) |
| InChIKey | PUZRSZVTWMMMCR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|