About thiourea;triphenylene
thiourea;triphenylene (PubChem CID 134360806) has the molecular formula C19H16N2S
and a molecular weight of 304.42 g/mol. Its IUPAC name is thiourea;triphenylene.
Molecular Properties
| Compound Name | thiourea;triphenylene |
| PubChem CID | 134360806 |
| Molecular Formula | C19H16N2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | thiourea;triphenylene |
| SMILES | NC(N)=S.c1ccc2c(c1)c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C18H12.CH4N2S/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18;2-1(3)4/h1-12H;(H4,2,3,4) |
| InChIKey | DGCPXXYYYXWVRJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze thiourea;triphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiourea;triphenylene?
The IUPAC name of thiourea;triphenylene (CID 134360806) is thiourea;triphenylene.
What is the SMILES notation for thiourea;triphenylene?
The canonical SMILES for thiourea;triphenylene is NC(N)=S.c1ccc2c(c1)c1ccccc1c1ccccc21.
What is the InChIKey of thiourea;triphenylene?
The InChIKey is DGCPXXYYYXWVRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12.CH4N2S/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18;2-1(3)4/h1-12H;(H4,2,3,4).
What are the key properties of thiourea;triphenylene?
thiourea;triphenylene has a molecular weight of 304.42 g/mol, XLogP of 4.33, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for thiourea;triphenylene is sourced from PubChem (CID 134360806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).