C26H22F7NO2S — CID 134361001
3-(3-benzylphenyl)sulfonyl-1-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine (PubChem CID 134361001) has the molecular formula C26H22F7NO2S and a molecular weight of 545.52 g/mol. Its IUPAC name is 3-(3-benzylphenyl)sulfonyl-1-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine.
| Compound Name | 3-(3-benzylphenyl)sulfonyl-1-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 134361001 |
| Molecular Formula | C26H22F7NO2S |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 3-(3-benzylphenyl)sulfonyl-1-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine |
| SMILES | O=S(=O)(c1cccc(Cc2ccccc2)c1)C1CCN(c2ccccc2C(F)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C26H22F7NO2S/c27-24(25(28,29)30,26(31,32)33)22-11-4-5-12-23(22)34-14-13-21(17-34)37(35,36)20-10-6-9-19(16-20)15-18-7-2-1-3-8-18/h1-12,16,21H,13-15,17H2 |
| InChIKey | OFJXIKSQTVHFQK-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |