About N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide
N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide (PubChem CID 134361087) has the molecular formula C10H15ClN4O2
and a molecular weight of 258.71 g/mol. Its IUPAC name is N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide |
| PubChem CID | 134361087 |
| Molecular Formula | C10H15ClN4O2 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide |
| SMILES | C/N=C/N(COC)Cc1cc(Cl)nnc1OC |
| InChI | InChI=1S/C10H15ClN4O2/c1-12-6-15(7-16-2)5-8-4-9(11)13-14-10(8)17-3/h4,6H,5,7H2,1-3H3/b12-6+ |
| InChIKey | HILWKGMKBSPAKB-WUXMJOGZSA-N |
| XLogP | 1.20 |
| TPSA | 59.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide?
The IUPAC name of N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide (CID 134361087) is N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide.
What is the SMILES notation for N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide?
The canonical SMILES for N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide is C/N=C/N(COC)Cc1cc(Cl)nnc1OC.
What is the InChIKey of N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide?
The InChIKey is HILWKGMKBSPAKB-WUXMJOGZSA-N. The full InChI is InChI=1S/C10H15ClN4O2/c1-12-6-15(7-16-2)5-8-4-9(11)13-14-10(8)17-3/h4,6H,5,7H2,1-3H3/b12-6+.
What are the key properties of N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide?
N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide has a molecular weight of 258.71 g/mol, XLogP of 1.20, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-chloro-3-methoxypyridazin-4-yl)methyl]-N-(methoxymethyl)-N'-methylmethanimidamide is sourced from PubChem (CID 134361087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).