C25H40O7 — CID 134361695
2-hydroxy-2-methylbutanedioic acid;(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid (PubChem CID 134361695) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is 2-hydroxy-2-methylbutanedioic acid;(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid.
| Compound Name | 2-hydroxy-2-methylbutanedioic acid;(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 134361695 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 2-hydroxy-2-methylbutanedioic acid;(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid |
| SMILES | CC(O)(CC(=O)O)C(=O)O.CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O2.C5H8O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;1-5(10,4(8)9)2-3(6)7/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22);10H,2H2,1H3,(H,6,7)(H,8,9)/b7-6-,10-9-,13-12-,16-15-; |
| InChIKey | GXHWBSVPSICIGB-XVSDJDOKSA-N |
| XLogP | 5.51 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|