About 5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one
5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one (PubChem CID 1343621) has the molecular formula C22H21NO2
and a molecular weight of 331.42 g/mol. Its IUPAC name is 5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one.
Molecular Properties
| Compound Name | 5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one |
| PubChem CID | 1343621 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one |
| SMILES | CCC1(CC)Cc2ccccc2-c2nc(-c3ccccc3)oc(=O)c21 |
| InChI | InChI=1S/C22H21NO2/c1-3-22(4-2)14-16-12-8-9-13-17(16)19-18(22)21(24)25-20(23-19)15-10-6-5-7-11-15/h5-13H,3-4,14H2,1-2H3 |
| InChIKey | MVQUVISFHVBFTO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one?
The IUPAC name of 5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one (CID 1343621) is 5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one.
What is the SMILES notation for 5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one?
The canonical SMILES for 5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one is CCC1(CC)Cc2ccccc2-c2nc(-c3ccccc3)oc(=O)c21.
What is the InChIKey of 5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one?
The InChIKey is MVQUVISFHVBFTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO2/c1-3-22(4-2)14-16-12-8-9-13-17(16)19-18(22)21(24)25-20(23-19)15-10-6-5-7-11-15/h5-13H,3-4,14H2,1-2H3.
What are the key properties of 5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one?
5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one has a molecular weight of 331.42 g/mol, XLogP of 4.98, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-diethyl-2-phenyl-6H-benzo[h][3,1]benzoxazin-4-one is sourced from PubChem (CID 1343621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).