C27H34N2O5S — CID 134362419
2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)-3-[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]propanamide (PubChem CID 134362419) has the molecular formula C27H34N2O5S and a molecular weight of 498.65 g/mol. Its IUPAC name is 2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)-3-[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]propanamide.
| Compound Name | 2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)-3-[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]propanamide |
|---|---|
| PubChem CID | 134362419 |
| Molecular Formula | C27H34N2O5S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)-3-[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]propanamide |
| SMILES | CC(CN1CC=C(c2ccc(-c3ccccc3)cc2)CC1)(C(=O)NOC1CCCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C27H34N2O5S/c1-27(35(2,31)32,26(30)28-34-25-10-6-7-19-33-25)20-29-17-15-24(16-18-29)23-13-11-22(12-14-23)21-8-4-3-5-9-21/h3-5,8-9,11-15,25H,6-7,10,16-20H2,1-2H3,(H,28,30) |
| InChIKey | IBADDFQGLNHAKP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|