C46H40F2N6O5 — CID 134363013
7-[5-[1-[[2-(difluoromethoxy)-5-(trityloxymethyl)phenyl]methyl]-2-methyl-3-oxoindazol-6-yl]pyrimidin-2-yl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one (PubChem CID 134363013) has the molecular formula C46H40F2N6O5 and a molecular weight of 794.86 g/mol. Its IUPAC name is 7-[5-[1-[[2-(difluoromethoxy)-5-(trityloxymethyl)phenyl]methyl]-2-methyl-3-oxoindazol-6-yl]pyrimidin-2-yl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one.
| Compound Name | 7-[5-[1-[[2-(difluoromethoxy)-5-(trityloxymethyl)phenyl]methyl]-2-methyl-3-oxoindazol-6-yl]pyrimidin-2-yl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one |
|---|---|
| PubChem CID | 134363013 |
| Molecular Formula | C46H40F2N6O5 |
| Molecular Weight | 794.86 g/mol |
| Exact Mass | 794.30 |
| IUPAC Name | 7-[5-[1-[[2-(difluoromethoxy)-5-(trityloxymethyl)phenyl]methyl]-2-methyl-3-oxoindazol-6-yl]pyrimidin-2-yl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one |
| SMILES | Cn1c(=O)c2ccc(-c3cnc(N4CCN5C(=O)OCC5C4)nc3)cc2n1Cc1cc(COC(c2ccccc2)(c2ccccc2)c2ccccc2)ccc1OC(F)F |
| InChI | InChI=1S/C46H40F2N6O5/c1-51-42(55)39-19-18-32(34-25-49-44(50-26-34)52-21-22-53-38(28-52)30-57-45(53)56)24-40(39)54(51)27-33-23-31(17-20-41(33)59-43(47)48)29-58-46(35-11-5-2-6-12-35,36-13-7-3-8-14-36)37-15-9-4-10-16-37/h2-20,23-26,38,43H,21-22,27-30H2,1H3 |
| InChIKey | BZTVJBBMHTWYRF-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 103.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.86 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|