C26H28N8O2 — CID 134363086
6-(1,3-dimethylindazol-6-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine;formamide (PubChem CID 134363086) has the molecular formula C26H28N8O2 and a molecular weight of 484.56 g/mol. Its IUPAC name is 6-(1,3-dimethylindazol-6-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine;formamide.
| Compound Name | 6-(1,3-dimethylindazol-6-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine;formamide |
|---|---|
| PubChem CID | 134363086 |
| Molecular Formula | C26H28N8O2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 6-(1,3-dimethylindazol-6-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine;formamide |
| SMILES | Cc1nn(C)c2cc(-c3cn4ccnc4c(Nc4ccc(N5CCOCC5)cc4)n3)ccc12.NC=O |
| InChI | InChI=1S/C25H25N7O.CH3NO/c1-17-21-8-3-18(15-23(21)30(2)29-17)22-16-32-10-9-26-25(32)24(28-22)27-19-4-6-20(7-5-19)31-11-13-33-14-12-31;2-1-3/h3-10,15-16H,11-14H2,1-2H3,(H,27,28);1H,(H2,2,3) |
| InChIKey | RWFLZFGVJTXVMM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|