C18H16ClF2NO3 — CID 134363705
ethyl 7-chloro-5-(2,4-difluorophenyl)-3-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine-2-carboxylate (PubChem CID 134363705) has the molecular formula C18H16ClF2NO3 and a molecular weight of 367.78 g/mol. Its IUPAC name is ethyl 7-chloro-5-(2,4-difluorophenyl)-3-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine-2-carboxylate.
| Compound Name | ethyl 7-chloro-5-(2,4-difluorophenyl)-3-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134363705 |
| Molecular Formula | C18H16ClF2NO3 |
| Molecular Weight | 367.78 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | ethyl 7-chloro-5-(2,4-difluorophenyl)-3-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)C1Oc2nc(Cl)cc(-c3ccc(F)cc3F)c2CC1C |
| InChI | InChI=1S/C18H16ClF2NO3/c1-3-24-18(23)16-9(2)6-13-12(8-15(19)22-17(13)25-16)11-5-4-10(20)7-14(11)21/h4-5,7-9,16H,3,6H2,1-2H3 |
| InChIKey | YPGBAMMBMSTODB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.78 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|