C15H10ClF2NO3 — CID 134363706
7-chloro-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-2-carboxylic acid (PubChem CID 134363706) has the molecular formula C15H10ClF2NO3 and a molecular weight of 325.70 g/mol. Its IUPAC name is 7-chloro-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 7-chloro-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 134363706 |
| Molecular Formula | C15H10ClF2NO3 |
| Molecular Weight | 325.70 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 7-chloro-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-2-carboxylic acid |
| SMILES | O=C(O)C1CCc2c(-c3ccc(F)cc3F)cc(Cl)nc2O1 |
| InChI | InChI=1S/C15H10ClF2NO3/c16-13-6-10(8-2-1-7(17)5-11(8)18)9-3-4-12(15(20)21)22-14(9)19-13/h1-2,5-6,12H,3-4H2,(H,20,21) |
| InChIKey | UAFWMRPBAFCEIC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|