C19H16F5N3O4 — CID 134363709
[(2S)-7-carbamoyl-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methyl-(2,2,2-trifluoroethyl)carbamic acid (PubChem CID 134363709) has the molecular formula C19H16F5N3O4 and a molecular weight of 445.34 g/mol. Its IUPAC name is [(2S)-7-carbamoyl-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methyl-(2,2,2-trifluoroethyl)carbamic acid.
| Compound Name | [(2S)-7-carbamoyl-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methyl-(2,2,2-trifluoroethyl)carbamic acid |
|---|---|
| PubChem CID | 134363709 |
| Molecular Formula | C19H16F5N3O4 |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | [(2S)-7-carbamoyl-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methyl-(2,2,2-trifluoroethyl)carbamic acid |
| SMILES | NC(=O)c1cc(-c2ccc(F)cc2F)c2c(n1)O[C@H](CN(CC(F)(F)F)C(=O)O)CC2 |
| InChI | InChI=1S/C19H16F5N3O4/c20-9-1-3-11(14(21)5-9)13-6-15(16(25)28)26-17-12(13)4-2-10(31-17)7-27(18(29)30)8-19(22,23)24/h1,3,5-6,10H,2,4,7-8H2,(H2,25,28)(H,29,30)/t10-/m0/s1 |
| InChIKey | KTOMMLKLDCFHHV-JTQLQIEISA-N |
| XLogP | 3.36 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |