C18H16ClF5N2O — CID 134363730
N-[[7-chloro-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methyl]-2,2,2-trifluoro-N-methylethanamine (PubChem CID 134363730) has the molecular formula C18H16ClF5N2O and a molecular weight of 406.78 g/mol. Its IUPAC name is N-[[7-chloro-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methyl]-2,2,2-trifluoro-N-methylethanamine.
| Compound Name | N-[[7-chloro-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methyl]-2,2,2-trifluoro-N-methylethanamine |
|---|---|
| PubChem CID | 134363730 |
| Molecular Formula | C18H16ClF5N2O |
| Molecular Weight | 406.78 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[[7-chloro-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-yl]methyl]-2,2,2-trifluoro-N-methylethanamine |
| SMILES | CN(CC1CCc2c(-c3ccc(F)cc3F)cc(Cl)nc2O1)CC(F)(F)F |
| InChI | InChI=1S/C18H16ClF5N2O/c1-26(9-18(22,23)24)8-11-3-5-13-14(7-16(19)25-17(13)27-11)12-4-2-10(20)6-15(12)21/h2,4,6-7,11H,3,5,8-9H2,1H3 |
| InChIKey | ZBJBYFLJWYEYBB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.78 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|