C19H18F5N3O2 — CID 134363734
5-(2,4-difluorophenyl)-2-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide (PubChem CID 134363734) has the molecular formula C19H18F5N3O2 and a molecular weight of 415.36 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-2-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide.
| Compound Name | 5-(2,4-difluorophenyl)-2-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 134363734 |
| Molecular Formula | C19H18F5N3O2 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 5-(2,4-difluorophenyl)-2-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide |
| SMILES | CN(CC1CCc2c(-c3ccc(F)cc3F)cc(C(N)=O)nc2O1)CC(F)(F)F |
| InChI | InChI=1S/C19H18F5N3O2/c1-27(9-19(22,23)24)8-11-3-5-13-14(12-4-2-10(20)6-15(12)21)7-16(17(25)28)26-18(13)29-11/h2,4,6-7,11H,3,5,8-9H2,1H3,(H2,25,28) |
| InChIKey | QCVOOLBKUHWWQR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |