C17H14ClF2NO3 — CID 134363752
ethyl 7-chloro-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-2-carboxylate (PubChem CID 134363752) has the molecular formula C17H14ClF2NO3 and a molecular weight of 353.75 g/mol. Its IUPAC name is ethyl 7-chloro-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-2-carboxylate.
| Compound Name | ethyl 7-chloro-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134363752 |
| Molecular Formula | C17H14ClF2NO3 |
| Molecular Weight | 353.75 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | ethyl 7-chloro-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)C1CCc2c(-c3ccc(F)cc3F)cc(Cl)nc2O1 |
| InChI | InChI=1S/C17H14ClF2NO3/c1-2-23-17(22)14-6-5-11-12(8-15(18)21-16(11)24-14)10-4-3-9(19)7-13(10)20/h3-4,7-8,14H,2,5-6H2,1H3 |
| InChIKey | XNQLZYLGVZNPBZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|