C18H16F5N3O2 — CID 134363766
(2R)-5-(2,4-difluorophenyl)-2-[(2,2,2-trifluoroethylamino)methyl]-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide (PubChem CID 134363766) has the molecular formula C18H16F5N3O2 and a molecular weight of 401.34 g/mol. Its IUPAC name is (2R)-5-(2,4-difluorophenyl)-2-[(2,2,2-trifluoroethylamino)methyl]-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide.
| Compound Name | (2R)-5-(2,4-difluorophenyl)-2-[(2,2,2-trifluoroethylamino)methyl]-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 134363766 |
| Molecular Formula | C18H16F5N3O2 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (2R)-5-(2,4-difluorophenyl)-2-[(2,2,2-trifluoroethylamino)methyl]-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(F)cc2F)c2c(n1)O[C@@H](CNCC(F)(F)F)CC2 |
| InChI | InChI=1S/C18H16F5N3O2/c19-9-1-3-11(14(20)5-9)13-6-15(16(24)27)26-17-12(13)4-2-10(28-17)7-25-8-18(21,22)23/h1,3,5-6,10,25H,2,4,7-8H2,(H2,24,27)/t10-/m1/s1 |
| InChIKey | VVDSHXJUPSHXHV-SNVBAGLBSA-N |
| XLogP | 2.97 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |