C17H13F5N2O2 — CID 134363823
(2R)-5-(2,4-difluorophenyl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide (PubChem CID 134363823) has the molecular formula C17H13F5N2O2 and a molecular weight of 372.29 g/mol. Its IUPAC name is (2R)-5-(2,4-difluorophenyl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide.
| Compound Name | (2R)-5-(2,4-difluorophenyl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 134363823 |
| Molecular Formula | C17H13F5N2O2 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (2R)-5-(2,4-difluorophenyl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(F)cc2F)c2c(n1)O[C@@H](CC(F)(F)F)CC2 |
| InChI | InChI=1S/C17H13F5N2O2/c18-8-1-3-10(13(19)5-8)12-6-14(15(23)25)24-16-11(12)4-2-9(26-16)7-17(20,21)22/h1,3,5-6,9H,2,4,7H2,(H2,23,25)/t9-/m1/s1 |
| InChIKey | VOLZXQHXNJPWLT-SECBINFHSA-N |
| XLogP | 3.77 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |