C17H14F2N2O2 — CID 134363894
(1S,9R)-6-(2,4-difluorophenyl)-12-oxa-3-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carboxamide (PubChem CID 134363894) has the molecular formula C17H14F2N2O2 and a molecular weight of 316.31 g/mol. Its IUPAC name is (1S,9R)-6-(2,4-difluorophenyl)-12-oxa-3-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carboxamide.
| Compound Name | (1S,9R)-6-(2,4-difluorophenyl)-12-oxa-3-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 134363894 |
| Molecular Formula | C17H14F2N2O2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (1S,9R)-6-(2,4-difluorophenyl)-12-oxa-3-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(F)cc2F)c2c(n1)[C@@H]1CC[C@H](C2)O1 |
| InChI | InChI=1S/C17H14F2N2O2/c18-8-1-3-10(13(19)5-8)11-7-14(17(20)22)21-16-12(11)6-9-2-4-15(16)23-9/h1,3,5,7,9,15H,2,4,6H2,(H2,20,22)/t9-,15+/m1/s1 |
| InChIKey | MTMLJAALOFBSKB-PSLIRLAXSA-N |
| XLogP | 2.90 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |