C20H25F3N4O2S — CID 134364708
tert-butyl (3aR,7aS)-2-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate (PubChem CID 134364708) has the molecular formula C20H25F3N4O2S and a molecular weight of 442.51 g/mol. Its IUPAC name is tert-butyl (3aR,7aS)-2-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl (3aR,7aS)-2-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 134364708 |
| Molecular Formula | C20H25F3N4O2S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | tert-butyl (3aR,7aS)-2-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2CN(c3ncnc4sc(CC(F)(F)F)cc34)C[C@@H]2C1 |
| InChI | InChI=1S/C20H25F3N4O2S/c1-19(2,3)29-18(28)26-5-4-12-8-27(10-13(12)9-26)16-15-6-14(7-20(21,22)23)30-17(15)25-11-24-16/h6,11-13H,4-5,7-10H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | NPOXICZYHPJTRN-OLZOCXBDSA-N |
| XLogP | 4.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |