C21H22F3N5OS2 — CID 134364767
4-[(3aR,7aS)-6-[(2-methoxy-3-pyridinyl)methyl]-3,3a,4,5,7,7a-hexahydro-[1,2]thiazolo[5,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine (PubChem CID 134364767) has the molecular formula C21H22F3N5OS2 and a molecular weight of 481.57 g/mol. Its IUPAC name is 4-[(3aR,7aS)-6-[(2-methoxy-3-pyridinyl)methyl]-3,3a,4,5,7,7a-hexahydro-[1,2]thiazolo[5,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[(3aR,7aS)-6-[(2-methoxy-3-pyridinyl)methyl]-3,3a,4,5,7,7a-hexahydro-[1,2]thiazolo[5,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 134364767 |
| Molecular Formula | C21H22F3N5OS2 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 4-[(3aR,7aS)-6-[(2-methoxy-3-pyridinyl)methyl]-3,3a,4,5,7,7a-hexahydro-[1,2]thiazolo[5,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
| SMILES | COc1ncccc1CN1CC[C@@H]2CN(c3ncnc4sc(CC(F)(F)F)cc34)S[C@@H]2C1 |
| InChI | InChI=1S/C21H22F3N5OS2/c1-30-19-14(3-2-5-25-19)9-28-6-4-13-10-29(32-17(13)11-28)18-16-7-15(8-21(22,23)24)31-20(16)27-12-26-18/h2-3,5,7,12-13,17H,4,6,8-11H2,1H3/t13-,17-/m1/s1 |
| InChIKey | SXVPLWMZEZGJFT-CXAGYDPISA-N |
| XLogP | 4.56 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|